![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[VID]](/icons/movie.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 650Projects04.pdf | 2008-03-08 06:21 | 2.9M | |
| 650Projects051.pdf | 2006-01-05 09:40 | 2.7M | |
| 732Projects05.pdf | 2005-06-07 05:26 | 2.8M | |
| AD534_b.pdf | 2005-03-15 05:10 | 162K | |
| ADV_CMOS_Part1-2.pdf | 2013-03-19 08:48 | 5.9M | |
| ADV_CMOS_Part3.pdf | 2014-04-30 05:04 | 7.2M | |
| ADV_MOSFET_Basics.pdf | 2013-03-06 04:00 | 572K | |
| ALIGN-ASML.pdf | 2011-10-10 07:46 | 2.1M | |
| AMRadio.wmv | 2013-03-10 05:18 | 8.1M | |
| ARCH 8250-10msds.pdf | 2002-11-15 14:00 | 26K | |
| ARCH8250db.pdf | 2001-06-19 11:29 | 2.1M | |
| ARCH8250ds.pdf | 2001-06-19 11:29 | 1.4M | |
| ARCXLTMSD.PDF | 2002-12-10 13:20 | 21K | |
| ARC_XL_series_presentation.pdf | 2002-09-23 07:06 | 185K | |
| ARC_i-CON-16_MSDS.pdf | 2008-03-04 07:41 | 617K | |
| ARC_icon_dsheet.pdf | 2008-02-13 12:07 | 289K | |
| AZ5214E_Resist.pdf | 2006-09-08 07:26 | 75K | |
| Accelerometer.xls | 2013-04-03 07:23 | 151K | |
| AccelerometerLab.wmv | 2011-03-26 03:42 | 15M | |
| Accelerometer_lab.pdf | 2014-04-25 07:57 | 2.8M | |
| AdvCmos2014.pdf | 2014-08-17 06:40 | 4.9M | |
| AdvCmosProcessIntegration.pdf | 2014-03-28 18:39 | 5.0M | |
| AdvCmosProcessSimulation.pdf | 2014-06-04 04:09 | 3.0M | |
| AluminumCalibration.pdf | 2014-07-15 10:33 | 1.8M | |
| Alumni.pdf | 2012-02-27 12:18 | 158K | |
| Anemometer.pdf | 2013-03-13 08:41 | 1.0M | |
| Anemometer_Lab.pdf | 2009-02-24 08:46 | 475K | |
| ArduinoMultiSensor.wmv | 2013-03-08 11:11 | 5.9M | |
| Asher_Recipes.pdf | 2009-08-15 03:13 | 343K | |
| BATMON_Demo_Video.wmv | 2010-09-05 04:22 | 12M | |
| BJT_Amplifiers.pdf | 2012-03-24 03:40 | 577K | |
| BJT_Basics.pdf | 2011-11-30 12:55 | 295K | |
| BJT_IC_Design.pdf | 2012-01-13 04:10 | 681K | |
| Basic_Analog_Circuits.pdf | 2014-09-17 16:55 | 946K | |
| BellLabDUV.pdf | 2003-01-31 13:36 | 4.2M | |
| BluetoothMicrocontroller.pdf | 2012-11-06 05:41 | 861K | |
| Bridge_Balance.xls | 2012-04-06 23:15 | 90K | |
| Bruce_Furnace.pdf | 2014-07-10 14:06 | 1.4M | |
| CE-BJT-Analysis-DC-AC-Freq.XLS | 2012-02-11 19:34 | 798K | |
| CE-BJT-Analysis.XLS | 2010-12-10 14:22 | 775K | |
| CE-BJT-Design.XLS | 2013-09-18 03:15 | 409K | |
| CE-BJT-Simple.XLS | 2012-03-21 10:58 | 97K | |
| CMOS-Shortcourse.html | 2014-05-27 04:41 | 9.6K | |
| CMOS.htm | 2014-01-18 12:10 | 12K | |
| CMOSTEST.pdf | 2011-03-03 19:11 | 3.2M | |
| CMOSTEST_Manual.pdf | 2008-12-14 21:04 | 3.6M | |
| CMOSTestchip2009.pdf | 2010-01-06 03:30 | 1.5M | |
| CMOSTestingJohnGalt1.pdf | 2011-03-03 19:18 | 7.8M | |
| CMOSVLSI2011.pdf | 2010-12-27 06:24 | 1.1M | |
| CMOS_Factory.ppt | 2014-08-17 06:28 | 5.1M | |
| CMOS_IC_Test.pdf | 2009-01-17 13:06 | 1.4M | |
| CMOS_Test_Parameter_Extractor.xls | 2009-11-10 03:39 | 258K | |
| CMOS_xsection.pdf | 2014-04-07 19:27 | 642K | |
| CMPseminar.ppt | 2005-10-17 07:13 | 4.7M | |
| CanonMarks2008Galt.xls | 2009-01-31 07:22 | 28K | |
| CapacitiveForceSensor.wmv | 2013-04-08 11:11 | 11M | |
| CapacitorCalculations.xls | 2009-04-07 02:37 | 261K | |
| CapacitorOscillator.wmv | 2013-04-08 07:39 | 3.5M | |
| CapacitorPressureSensor.wmv | 2013-04-08 08:17 | 5.1M | |
| Capacitor_Lab.pdf | 2013-04-09 02:13 | 1.5M | |
| Capacitor_Sensors.pdf | 2011-04-03 05:55 | 1.7M | |
| Chemical_Sensors.pdf | 2012-02-27 12:55 | 2.9M | |
| Coat_Expose_Develop.pdf | 2011-09-27 05:02 | 832K | |
| Combinational_Sequential_Circuits.pdf | 2014-10-31 03:19 | 2.3M | |
| Concentration_Calc.xls | 2010-04-27 01:30 | 18K | |
| Conversion_Circuits.pdf | 2009-04-28 11:18 | 924K | |
| Costloan.xls | 2013-01-02 08:27 | 19K | |
| DAROCUR 1173 MSDS USA.PDF | 2007-06-13 09:12 | 33K | |
| DRM_Lab_manual_20111.pdf | 2011-10-20 05:52 | 102K | |
| DUV32_Data_Sheet.pdf | 2002-12-10 13:18 | 512K | |
| DUV32_MSDS.pdf | 2002-12-10 13:18 | 23K | |
| DUV ARC Overview.pdf | 2002-09-23 06:56 | 1.4M | |
| DUV product overview.pdf | 2001-06-18 04:45 | 649K | |
| Defects.pdf | 2014-04-30 05:16 | 3.8M | |
| Device_Test.pdf | 2014-04-30 05:13 | 3.9M | |
| DiaphragmCalculations.xls | 2014-02-12 08:54 | 207K | |
| Diaphragm_Deflection.wmv | 2013-03-11 07:22 | 2.9M | |
| Diffusion_Mask_Calc_v3.xls | 2010-08-22 11:58 | 217K | |
| Diffuson.xls | 2006-04-08 05:08 | 64K | |
| Dill_Lab_20111.pdf | 2011-10-20 06:00 | 105K | |
| Dill_MeasDevelopEtch.pdf | 2002-12-11 23:04 | 442K | |
| Dill_OpticalLitho.pdf | 2002-12-11 23:11 | 486K | |
| Dill_PosResChar.pdf | 2002-12-06 11:47 | 1.4M | |
| Dill_ProjectionPrintModel.pdf | 2002-12-11 23:08 | 758K | |
| Diode_Lab.pdf | 2013-04-21 03:55 | 2.6M | |
| Diode_Review.pdf | 2010-11-20 06:23 | 1.0M | |
| Diode_Sensors_Theory.pdf | 2012-01-22 04:34 | 1.8M | |
| DoubleExposure.pdf | 2014-02-05 07:31 | 507K | |
| Dr_Fuller_Research_Portfolio.pdf | 2011-11-05 03:50 | 7.6M | |
| EE688_thermal_actuators_5-5-09.pdf | 2009-05-08 02:21 | 344K | |
| EE688_viscosity_sensor_March_2011.pdf | 2011-03-05 13:37 | 2.4M | |
| EEEE482LabOutline.pdf | 2014-08-18 06:18 | 310K | |
| EEEE482_Lab0_Rev2_1.pdf | 2013-09-11 04:46 | 78K | |
| EEEE482_Lab1_Rev2_3.doc | 2013-09-29 06:43 | 669K | |
| EEEE482_Lab2_Rev2_0.doc | 2013-08-15 05:37 | 198K | |
| EEEE482_Lab3_Rev1_3.doc | 2013-08-15 05:39 | 267K | |
| EEEE482_Lab4_Rev2_6.doc | 2013-08-15 05:44 | 2.4M | |
| EEEE482_Lab5_Rev2_7.doc | 2013-08-15 05:46 | 451K | |
| EEEE482_Lab6_Rev2_5.doc | 2013-08-15 05:49 | 582K | |
| EEEE482_Lab7_Rev2_4.doc | 2013-08-15 05:52 | 502K | |
| EEEE482_Lab8_Rev2_3.doc | 2013-08-15 05:54 | 531K | |
| EEEE482_tech_memo.doc | 2013-08-13 12:38 | 43K | |
| EEPROM.pdf | 2012-02-22 11:50 | 2.3M | |
| ETM_Mask.pdf | 2009-05-09 18:26 | 321K | |
| Electrodynamic_Shaker.wmv | 2010-02-17 12:00 | 2.5M | |
| Energy_Harvesting.pdf | 2013-10-16 17:35 | 3.6M | |
| EtchDepRates.pdf | 2013-06-27 10:06 | 23K | |
| Ethyleneglycoldiacrylate.pdf | 2007-06-12 09:38 | 62K | |
| FFEM HPR 500 g-line.pdf | 2007-10-23 06:21 | 132K | |
| FOCEX2.pdf | 2005-03-29 06:06 | 610K | |
| FULLER_RIT_MOSFET_MODELS.txt | 2010-04-01 11:16 | 6.0K | |
| FactoryProducts.pdf | 2009-02-20 02:50 | 692K | |
| Factory_Lith.pdf | 2007-09-04 05:00 | 1.2M | |
| Feedback.pdf | 2014-10-09 10:48 | 1.2M | |
| Feedback_Lab.pdf | 2014-10-14 08:13 | 325K | |
| Fluid_Channels.pdf | 2012-10-24 16:50 | 2.2M | |
| Frequency_Response.pdf | 2014-09-25 03:13 | 1.0M | |
| Fuller_Bulk_MEMS_Pressure_Sensor.pdf | 2007-03-09 11:02 | 73K | |
| Fuller_Bulk_MEMS_Pressure_Sensor2.pdf | 2005-04-15 11:56 | 2.9M | |
| Gas_Flow.wmv | 2013-03-08 09:12 | 5.0M | |
| GigOhmResistors.ppt | 2010-10-01 09:43 | 4.3M | |
| HPR-504 Data Sheet.pdf | 2007-10-11 04:43 | 730K | |
| HPR 504 MSDS.pdf | 2007-10-23 06:21 | 41K | |
| High_Speed_Logic.pdf | 2014-11-06 13:33 | 1.8M | |
| Humidity_Sensor.pdf | 2011-04-03 06:17 | 1.1M | |
| IBMDUV.pdf | 2003-01-31 13:38 | 2.5M | |
| IMPLANT.pdf | 2012-01-20 12:47 | 1.3M | |
| ImplantMaskCalculator.xls | 2006-04-08 05:21 | 153K | |
| Imprint20071214.pdf | 2007-12-14 09:03 | 94K | |
| Intra_Ocular_Pressure.pdf | 2006-01-06 07:58 | 1.7M | |
| IntroDigitalElectronics.pdf | 2014-11-02 13:14 | 2.9M | |
| IntroVLSI.pdf | 2013-11-11 03:13 | 3.2M | |
| Intro_Device_Test.pdf | 2007-11-16 03:05 | 2.3M | |
| Intro_Electronics.pdf | 2006-10-31 11:47 | 521K | |
| Intro_to_LTSPICE.pdf | 2014-01-17 05:04 | 1.3M | |
| Intro_to_LTSPICE.wmv | 2013-04-05 11:38 | 19M | |
| IonImplt.xls | 2006-04-08 05:08 | 40K | |
| Isobornylacrylate.pdf | 2007-06-12 09:37 | 49K | |
| KS_Wafer_Saw.pdf | 2012-03-20 07:38 | 852K | |
| LEC_MASK.pdf | 2010-12-28 06:13 | 5.1M | |
| LEC_MESA.pdf | 2013-08-23 10:55 | 1.1M | |
| LEC_MODL.pdf | 2010-12-29 18:26 | 574K | |
| LEC_STEP.pdf | 2007-10-12 07:32 | 3.6M | |
| LPCVD_Recipes.pdf | 2013-11-27 08:56 | 2.0M | |
| LabNotebookExample.pdf | 2004-08-03 05:43 | 6.6M | |
| Lab_BJT_Characterization.pdf | 2014-02-12 05:52 | 1.6M | |
| Lab_Notebook_2123.pdf | 2013-03-28 06:12 | 50K | |
| Lab_Report_Guidelines.pdf | 2012-01-11 08:37 | 44K | |
| Lab_SPICE_Intro.pdf | 2014-09-03 10:39 | 1.5M | |
| Lam4600_Etcher.pdf | 2013-11-16 04:33 | 942K | |
| Lec_CAD.pdf | 2014-06-09 10:09 | 1.3M | |
| Lec_drm.pdf | 2005-03-29 06:06 | 1.3M | |
| Lift-Off.pdf | 2012-09-19 03:01 | 1.6M | |
| Lift-off-movie.wmv | 2012-02-28 06:40 | 4.5M | |
| Lithography-ASML.pdf | 2014-04-30 05:06 | 1.8M | |
| MAquilinoThesis.pdf | 2007-03-07 08:55 | 4.8M | |
| MEMS2012.pdf | 2011-12-10 07:30 | 832K | |
| MEMS_20102_Process_Flow.pdf | 2011-03-05 13:35 | 51K | |
| MEMS_Bulk_Design.pdf | 2012-09-26 10:20 | 3.1M | |
| MEMS_Bulk_Fabrication_Process.pdf | 2014-03-07 05:51 | 2.5M | |
| MEM_Actuators.pdf | 2012-10-21 14:47 | 3.9M | |
| MEM_App_Fluids.pdf | 2012-10-23 15:57 | 1.6M | |
| MEM_App_Pumps.pdf | 2012-10-24 16:35 | 2.7M | |
| MEM_DEP.pdf | 2012-09-18 06:56 | 3.1M | |
| MEM_ETCH.pdf | 2012-09-18 11:34 | 3.1M | |
| MEM_LITH.pdf | 2012-09-18 07:18 | 3.0M | |
| MEM_MECH.pdf | 2011-03-21 15:04 | 2.6M | |
| MESAHELP.pdf | 2014-08-25 12:13 | 453K | |
| MOSFET-Long-Short-Intro.pdf | 2014-10-13 07:53 | 1.8M | |
| MOS_Inverter.pdf | 2014-10-26 03:31 | 1.2M | |
| MPX2202.pdf | 2010-03-25 01:40 | 358K | |
| Mack.pdf | 2002-12-12 15:27 | 13M | |
| Mack_DoD_ABC.pdf | 2006-01-12 12:30 | 415K | |
| May2001.pdf | 2008-03-08 06:41 | 12M | |
| Mem_App_Switches.pdf | 2014-09-17 03:05 | 2.9M | |
| Mem_proc.pdf | 2012-09-18 11:37 | 1.2M | |
| Mentor_Tools.pdf | 2007-07-24 06:37 | 1.3M | |
| MicroBolometer.pdf | 2014-11-06 19:00 | 1.1M | |
| MicroE-NewsLetter5Aug2013.pdf | 2013-08-08 09:11 | 307K | |
| MicroE-NewsLetter5Feb2014.pdf | 2014-02-05 08:16 | 247K | |
| MicroE-NewsLetter12Aug2013.pdf | 2013-08-18 14:39 | 307K | |
| MicroE-NewsLetter15Aug2014.pdf | 2014-08-12 03:33 | 232K | |
| MicroE-NewsLetter15July2014.pdf | 2014-07-15 15:51 | 244K | |
| MicroE-NewsLetter17Oct2013.pdf | 2013-10-16 07:55 | 256K | |
| MicroE-NewsLetter18Mar14.pdf | 2014-03-18 10:51 | 134K | |
| MicroE-NewsLetter22Jan2014.pdf | 2014-01-22 06:59 | 175K | |
| MicroE-NewsLetter25July2013.pdf | 2013-07-29 07:17 | 294K | |
| MicrocontrollerBasics.pdf | 2011-05-02 05:10 | 1.6M | |
| MicrophoneDesignPresentation.pdf | 2014-09-17 16:25 | 1.3M | |
| Microphone_Analog_AKU1126_Datasheet.pdf | 2010-01-13 13:56 | 212K | |
| Mobility.xls | 2006-04-08 05:08 | 16K | |
| Molecular biology of the gene (Watson, Baker, Bell, Gann, Levine, Losick - 2004 - 5th ed. - Pearson).pdf | 2014-08-12 20:04 | 107M | |
| Mosfetiv.xls | 2009-03-29 11:07 | 55K | |
| Mosfetvt.xls | 2006-04-08 05:08 | 52K | |
| NMOS_Inv_Lab.pdf | 2014-11-03 08:17 | 528K | |
| NMOS_TEST_DATA.xls | 2013-10-31 02:39 | 2.2M | |
| Nanoimprinting-Glenn_clearbackground.pdf | 2007-09-06 07:54 | 3.1M | |
| OiR620-10msds.pdf | 2002-06-11 14:14 | 25K | |
| OiR620_data.pdf | 2002-06-11 14:14 | 3.2M | |
| OpAmpSingleSupply.pdf | 2012-02-29 06:27 | 1.1M | |
| OpticalFilmThicknessMeasurements.pdf | 2014-03-07 08:30 | 1.1M | |
| Optical_Basics_MEMS.pdf | 2013-03-29 13:16 | 4.0M | |
| Out_770.pdf | 2014-08-27 04:47 | 298K | |
| Out_787.pdf | 2014-01-17 06:05 | 187K | |
| Outline.pdf | 2014-05-26 17:30 | 146K | |
| Oxide.xls | 2014-07-08 16:27 | 51K | |
| PCB_Etching.wmv | 2013-03-11 09:01 | 13M | |
| PCB_Protoboard_Components.pdf | 2012-11-05 05:44 | 4.2M | |
| PMGEA_Sigma-Aldrich_MSDS.pdf | 2013-03-07 07:59 | 586K | |
| PMOS.PPT | 2006-05-24 08:38 | 1.8M | |
| PMOS150.pdf | 2013-08-13 08:17 | 2.5M | |
| PMOS_Digital_Test.pdf | 2014-07-16 05:11 | 1.5M | |
| PMOS_IC_Test.pdf | 2008-03-08 06:46 | 8.5M | |
| PMOS_TEST_DATA.xls | 2013-10-31 02:37 | 2.2M | |
| PMOS_Test.pdf | 2010-11-12 10:37 | 6.3M | |
| PRISMhumidity.wmv | 2011-03-28 15:09 | 13M | |
| PROCESS.pdf | 2007-12-19 03:36 | 3.4M | |
| PVD_Recipes.pdf | 2013-11-27 08:42 | 3.4M | |
| Parts_List.xls | 2009-06-10 04:37 | 25K | |
| Photoinitiators for UV curing.pdf | 2007-06-13 12:18 | 1.4M | |
| Piezoresistance.pdf | 2012-04-03 10:40 | 192K | |
| PlasmaEtch.wmv | 2013-10-18 10:22 | 15M | |
| Plasma_Etch.pdf | 2013-04-17 07:29 | 2.8M | |
| Power_Conditioning.pdf | 2012-01-22 04:59 | 517K | |
| Pressure_Sensor_Lab.pdf | 2014-02-09 05:10 | 1.8M | |
| Product_Overview_arcs.pdf | 2002-09-23 07:02 | 1.0M | |
| Projects2006.pdf | 2007-01-12 09:22 | 2.7M | |
| PuchadesJMEMSPaperJune2011.pdf | 2011-06-15 05:32 | 375K | |
| PulseWidthAccelerometer.wmv | 2013-03-26 08:02 | 6.4M | |
| Quad_Recipes.pdf | 2013-10-14 12:24 | 4.5M | |
| RCA Project Paper Fuller.pdf | 2013-08-18 05:31 | 192K | |
| RCA_Kern_Puotinen.pdf | 2013-08-18 04:17 | 139K | |
| REVIEW.pdf | 2014-07-10 13:59 | 876K | |
| RITMicrophone.wmv | 2013-03-09 08:27 | 11M | |
| RITWireBond.wmv | 2014-05-27 10:46 | 7.6M | |
| RIT_Gas_Flow_Sensor.pdf | 2013-03-13 08:37 | 1.1M | |
| RIT_Package.pdf | 2013-03-11 12:06 | 8.4M | |
| ReducingOxygenUsage.pdf | 2014-08-10 09:32 | 1.3M | |
| Resistor_Lab.pdf | 2013-03-13 08:33 | 1.7M | |
| Resistors_Poly.xls | 2010-03-23 02:24 | 20K | |
| RobManley_MicroChemLab.pdf | 2007-05-01 10:50 | 965K | |
| S1813_MSDS.pdf | 2004-09-10 11:13 | 29K | |
| S1813_datasheet.pdf | 2004-06-25 10:24 | 2.3M | |
| SILVACO.pdf | 2010-11-15 14:16 | 2.2M | |
| SPC_Update_Manual.pdf | 2006-08-29 11:18 | 2.4M | |
| SPICE.pdf | 2013-11-15 04:14 | 1.9M | |
| SPICE_Examples.pdf | 2014-01-02 04:57 | 1.8M | |
| SPICE_MOSFET_Model_Intro.pdf | 2014-04-10 10:33 | 2.3M | |
| SPICE_MOSFET_Models.pdf | 2013-12-27 07:45 | 1.5M | |
| SPICE_More_Examples.pdf | 2014-01-06 16:29 | 1.5M | |
| SPIE_sample_full.pdf | 2007-11-12 14:08 | 220K | |
| STI_CMP.pdf | 2007-09-27 09:51 | 5.5M | |
| SVG_Backup_Recipes_for_SSI.ppt | 2014-04-08 15:39 | 1.2M | |
| Selected_Filter_Circuits.pdf | 2009-10-23 02:24 | 309K | |
| SmartPhoneLabs.pdf | 2013-03-04 05:59 | 1.7M | |
| Steve_Parshall_Final_V2.pdf | 2007-05-01 09:43 | 2.5M | |
| Sub-CMOS_Pictures.pdf | 2009-10-08 01:26 | 1.5M | |
| SubCmos2014.pdf | 2014-08-17 06:36 | 5.6M | |
| SurfaceMEMsDesign.pdf | 2014-10-10 10:03 | 2.3M | |
| SurfaceMEMsDesignExamples.pdf | 2014-10-10 09:59 | 1.8M | |
| SurfaceMEMsFabricationDetails.pdf | 2014-11-07 03:31 | 3.5M | |
| SurfaceMountPCBAssembly.wmv | 2013-03-11 08:17 | 13M | |
| SwingCurve_Lab_20121.pdf | 2012-08-28 09:39 | 72K | |
| TCAD-SILVACO.pdf | 2014-04-30 05:08 | 2.0M | |
| TEST_DIG.pdf | 2007-03-08 05:13 | 2.6M | |
| TSMR-iN008 PM MSDS.pdf | 2009-12-11 10:33 | 83K | |
| T_LOG_D.pdf | 2005-03-29 06:06 | 108K | |
| TestResults.ppt | 2009-02-20 03:29 | 5.5M | |
| Testing-Device-Problem-Analysis.pdf | 2013-02-07 09:27 | 3.8M | |
| ThermalMicroActuatorMirror.wmv | 2013-03-11 08:44 | 8.8M | |
| Tones.wmv | 2012-05-07 09:01 | 1.4M | |
| Transmitter.wmv | 2013-03-11 15:54 | 12M | |
| Turbidity.wmv | 2009-07-08 06:54 | 899K | |
| Two_Level_Metal.pdf | 2010-02-16 18:55 | 3.6M | |
| UVIII-0.5 MSDS.pdf | 2003-01-23 14:03 | 27K | |
| UVIII Datasheet.pdf | 2003-01-21 14:32 | 195K | |
| VLSI-CAD.pdf | 2014-11-04 03:15 | 1.7M | |
| VideoPresentation.ppt | 2013-04-03 07:37 | 2.3M | |
| WaterLevelSensor.wmv | 2013-04-08 10:54 | 8.3M | |
| XL Data Sheet_barc.pdf | 2002-12-10 13:19 | 619K | |
| align.pdf | 2008-01-14 05:35 | 4.4M | |
| arc29a_datasheet.pdf | 2006-01-31 14:38 | 808K | |
| autosched.ppt | 2006-01-27 04:08 | 624K | |
| backend.pdf | 2011-05-04 07:09 | 7.3M | |
| backside alignment.pdf | 2005-04-11 11:37 | 440K | |
| bluebooties.pdf | 2008-01-29 16:45 | 2.7M | |
| bowen_SU8stress_report.pdf | 2012-03-01 06:49 | 506K | |
| bowen_cinar_0305-320_project_presentation_final.pdf | 2012-05-17 10:06 | 847K | |
| butylacrylate.pdf | 2007-06-12 09:34 | 73K | |
| carrier_conc.xls | 2006-04-10 12:14 | 46K | |
| chem3.pdf | 2014-01-13 16:02 | 22M | |
| chris.ppt | 2007-02-28 06:28 | 6.9M | |
| companynotebook.pdf | 2002-06-11 14:13 | 193K | |
| cycle.pdf | 2011-01-21 06:07 | 463K | |
| darocur_1173-2.pdf | 2007-06-13 07:57 | 42K | |
| defects.pdf | 2003-12-05 09:53 | 5.4M | |
| doc2549.pdf | 2013-12-03 20:37 | 7.2M | |
| duv1.pdf | 2003-01-30 11:19 | 678K | |
| duv2.pdf | 2003-01-30 11:22 | 1.4M | |
| eisenhart_01.gif | 2007-01-04 07:45 | 9.2K | |
| eisenhart_03.gif | 2007-01-04 07:45 | 5.7K | |
| eisenhart_05.gif | 2007-01-04 07:45 | 716 | |
| eisenhart_09.gif | 2007-01-04 07:45 | 456 | |
| eisenhart_11.gif | 2007-01-04 07:45 | 728 | |
| eisenhart_13.gif | 2007-01-04 07:45 | 678 | |
| eisenhart_15.gif | 2007-01-04 07:45 | 809 | |
| eisenhart_17.gif | 2007-01-04 07:45 | 456 | |
| eisenhart_19.gif | 2007-01-04 07:45 | 728 | |
| eisenhart_21.gif | 2007-01-04 07:45 | 678 | |
| eisenhart_23.gif | 2007-01-04 07:45 | 654 | |
| eisenhart_25.gif | 2007-01-04 07:45 | 638 | |
| eisenhart_27.gif | 2007-01-04 07:45 | 633 | |
| eisenhart_2003.gif | 2007-01-04 07:45 | 14K | |
| evaporation.xls | 2012-01-26 16:50 | 58K | |
| eyupCinarSU8_stress2012.pdf | 2012-05-17 10:05 | 212K | |
| fac_pfrm.pdf | 2012-12-31 05:00 | 147K | |
| handcalcADV_CMOS.pdf | 2014-03-28 13:35 | 930K | |
| historyofmems.pdf | 2011-11-27 11:59 | 12M | |
| holder-03.gif | 2007-01-04 07:45 | 1.0K | |
| input.xls | 2006-01-27 04:08 | 268K | |
| irgacure651_MSDS.pdf | 2007-06-14 05:21 | 711K | |
| irgacure_651.pdf | 2007-06-13 12:18 | 35K | |
| jeol_guide.pdf | 2005-03-08 05:11 | 1.1M | |
| laboratory_manuscrpit_sample.pdf | 2002-06-11 14:14 | 12K | |
| lam490_recipes.pdf | 2007-12-24 04:26 | 633K | |
| lec_DRAM.pdf | 2005-01-05 11:51 | 708K | |
| lec_cmp.pdf | 2010-03-28 15:22 | 4.0M | |
| lec_cvd.pdf | 2013-04-24 09:25 | 1.8M | |
| lec_deft.pdf | 2008-01-29 16:47 | 3.7M | |
| lec_reli.pdf | 2005-01-05 11:51 | 208K | |
| lec_rtp.pdf | 2010-03-28 05:42 | 905K | |
| lec_schl.pdf | 2012-12-31 12:39 | 601K | |
| lec_tqm.pdf | 2012-12-12 05:22 | 590K | |
| mem_app_bio.pdf | 2006-05-17 11:07 | 9.0M | |
| mem_app_mic.pdf | 2012-05-10 05:32 | 5.2M | |
| mem_chem.pdf | 2011-04-23 17:40 | 6.8M | |
| mem_meas.pdf | 2012-04-26 05:22 | 3.7M | |
| mem_probes.pdf | 2012-10-31 02:37 | 7.4M | |
| mem_sem.pdf | 2014-04-23 07:28 | 4.1M | |
| nanospec.pdf | 2013-09-18 11:51 | 157K | |
| nose.pdf | 2006-05-09 08:25 | 306K | |
| out_550.pdf | 2014-08-17 06:08 | 356K | |
| out_732.pdf | 2014-01-10 12:26 | 302K | |
| out_EEEE482.pdf | 2014-08-26 10:12 | 407K | |
| page_height.gif | 2007-01-04 07:45 | 62 | |
| par_count.pdf | 2013-02-06 03:44 | 1.2M | |
| pecvd_recipes.pdf | 2008-09-06 07:14 | 1.0M | |
| piscani_resist_review.pdf | 2006-03-08 09:49 | 1.7M | |
| pn_electrostatics_current_temp.xls | 2011-04-21 19:35 | 97K | |
| resistor_mems.pdf | 2011-12-05 04:15 | 1.4M | |
| s812msds.pdf | 2002-06-11 14:14 | 24K | |
| schedule.pdf | 2014-08-12 03:23 | 75K | |
| spie1986.pdf | 2002-12-19 11:33 | 1.5M | |
| spie1994.pdf | 2002-12-19 11:34 | 3.2M | |
| standing_waves.pdf | 2003-01-18 12:50 | 12M | |
| stress_measurement.pdf | 2006-02-28 05:29 | 459K | |
| superko.pdf | 2002-06-11 14:14 | 84K | |
| surface.pdf | 2011-01-29 06:47 | 3.9M | |
| surfacemount.pdf | 2012-10-25 07:44 | 5.6M | |
| swing_curve.pdf | 2003-01-18 12:55 | 11M | |
| thermal_actuator_simulation.pdf | 2006-05-02 08:09 | 1.0M | |
| thermalactuator.xls | 2006-05-02 08:07 | 21K | |
| understanding_BARC.pdf | 2002-09-23 07:00 | 632K | |
| understanding_arc.pdf | 2002-09-23 06:58 | 593K | |
| wafer_thinning.pdf | 2010-01-04 13:35 | 319K | |
| webpagestatistics.pdf | 2013-10-06 06:04 | 116K | |
| wet_etch.pdf | 2008-10-08 06:27 | 1.6M | |